C18H25NO6S2 — CID 124766687
methyl 5-[(2S,3R,4R)-4-benzamido-3-methylsulfonyloxythiolan-2-yl]pentanoate (PubChem CID 124766687) has the molecular formula C18H25NO6S2 and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl 5-[(2S,3R,4R)-4-benzamido-3-methylsulfonyloxythiolan-2-yl]pentanoate.
| Compound Name | methyl 5-[(2S,3R,4R)-4-benzamido-3-methylsulfonyloxythiolan-2-yl]pentanoate |
|---|---|
| PubChem CID | 124766687 |
| Molecular Formula | C18H25NO6S2 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 5-[(2S,3R,4R)-4-benzamido-3-methylsulfonyloxythiolan-2-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1SC[C@H](NC(=O)c2ccccc2)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C18H25NO6S2/c1-24-16(20)11-7-6-10-15-17(25-27(2,22)23)14(12-26-15)19-18(21)13-8-4-3-5-9-13/h3-5,8-9,14-15,17H,6-7,10-12H2,1-2H3,(H,19,21)/t14-,15-,17+/m0/s1 |
| InChIKey | NWNDHJXWNGVMQZ-YQQAZPJKSA-N |
| XLogP | 1.98 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|