C20H26N2O7S — CID 162847472
acetyl (5R)-5-[(2R,3R,4S)-3-acetyloxy-4-benzamidothiolan-2-yl]-5-(hydroxyamino)pentanoate (PubChem CID 162847472) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is acetyl (5R)-5-[(2R,3R,4S)-3-acetyloxy-4-benzamidothiolan-2-yl]-5-(hydroxyamino)pentanoate.
| Compound Name | acetyl (5R)-5-[(2R,3R,4S)-3-acetyloxy-4-benzamidothiolan-2-yl]-5-(hydroxyamino)pentanoate |
|---|---|
| PubChem CID | 162847472 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | acetyl (5R)-5-[(2R,3R,4S)-3-acetyloxy-4-benzamidothiolan-2-yl]-5-(hydroxyamino)pentanoate |
| SMILES | CC(=O)OC(=O)CCC[C@@H](NO)[C@H]1SC[C@@H](NC(=O)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H26N2O7S/c1-12(23)28-17(25)10-6-9-15(22-27)19-18(29-13(2)24)16(11-30-19)21-20(26)14-7-4-3-5-8-14/h3-5,7-8,15-16,18-19,22,27H,6,9-11H2,1-2H3,(H,21,26)/t15-,16-,18-,19-/m1/s1 |
| InChIKey | DARYWTWIBAYGJK-PSBWJHGTSA-N |
| XLogP | 1.44 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|