C16H21NO4S — CID 26434661
5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoic acid (PubChem CID 26434661) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 26434661 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H](NC(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H21NO4S/c18-14(19)9-5-4-8-13-15(20)12(10-22-13)17-16(21)11-6-2-1-3-7-11/h1-3,6-7,12-13,15,20H,4-5,8-10H2,(H,17,21)(H,18,19)/t12-,13+,15+/m1/s1 |
| InChIKey | NKOOGOGYJCUKMS-IPYPFGDCSA-N |
| XLogP | 1.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|