C29H33N3O6S2 — CID 124894156
ethyl 4-[(1R,2R,3S,6R,7R,8R,11E)-1,3-dibenzamido-2-hydroxy-11-hydroxyimino-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate (PubChem CID 124894156) has the molecular formula C29H33N3O6S2 and a molecular weight of 583.73 g/mol. Its IUPAC name is ethyl 4-[(1R,2R,3S,6R,7R,8R,11E)-1,3-dibenzamido-2-hydroxy-11-hydroxyimino-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate.
| Compound Name | ethyl 4-[(1R,2R,3S,6R,7R,8R,11E)-1,3-dibenzamido-2-hydroxy-11-hydroxyimino-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate |
|---|---|
| PubChem CID | 124894156 |
| Molecular Formula | C29H33N3O6S2 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | ethyl 4-[(1R,2R,3S,6R,7R,8R,11E)-1,3-dibenzamido-2-hydroxy-11-hydroxyimino-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@H]1[C@H]2SC[C@@H](NC(=O)c3ccccc3)[C@@]2(O)[C@@]2(NC(=O)c3ccccc3)CS[C@H]1/C2=N/O |
| InChI | InChI=1S/C29H33N3O6S2/c1-2-38-22(33)15-9-14-20-23-24(32-37)28(17-40-23,31-27(35)19-12-7-4-8-13-19)29(36)21(16-39-25(20)29)30-26(34)18-10-5-3-6-11-18/h3-8,10-13,20-21,23,25,36-37H,2,9,14-17H2,1H3,(H,30,34)(H,31,35)/b32-24-/t20-,21-,23-,25-,28-,29+/m1/s1 |
| InChIKey | DBWVBLINPCKLCP-UWAIYCGRSA-N |
| XLogP | 3.11 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|