C18H24O2S — CID 71344596
ethyl 4-(4-phenylsulfanylcyclohex-2-en-1-yl)butanoate (PubChem CID 71344596) has the molecular formula C18H24O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is ethyl 4-(4-phenylsulfanylcyclohex-2-en-1-yl)butanoate.
| Compound Name | ethyl 4-(4-phenylsulfanylcyclohex-2-en-1-yl)butanoate |
|---|---|
| PubChem CID | 71344596 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | ethyl 4-(4-phenylsulfanylcyclohex-2-en-1-yl)butanoate |
| SMILES | CCOC(=O)CCCC1C=CC(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C18H24O2S/c1-2-20-18(19)10-6-7-15-11-13-17(14-12-15)21-16-8-4-3-5-9-16/h3-5,8-9,11,13,15,17H,2,6-7,10,12,14H2,1H3 |
| InChIKey | RFZHVLVJOSHBQM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|