C18H23ClO4S — CID 51794453
diethyl (1R,2S,4R,5S)-4-chloro-5-phenylsulfanylcyclohexane-1,2-dicarboxylate (PubChem CID 51794453) has the molecular formula C18H23ClO4S and a molecular weight of 370.90 g/mol. Its IUPAC name is diethyl (1R,2S,4R,5S)-4-chloro-5-phenylsulfanylcyclohexane-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2S,4R,5S)-4-chloro-5-phenylsulfanylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 51794453 |
| Molecular Formula | C18H23ClO4S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | diethyl (1R,2S,4R,5S)-4-chloro-5-phenylsulfanylcyclohexane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](Cl)[C@@H](Sc2ccccc2)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C18H23ClO4S/c1-3-22-17(20)13-10-15(19)16(11-14(13)18(21)23-4-2)24-12-8-6-5-7-9-12/h5-9,13-16H,3-4,10-11H2,1-2H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | AUTVLJMYUKTMEB-JJXSEGSLSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|