C17H18N2O4S — CID 11046233
ethyl (1R,4R,5R,6R)-2',5'-dioxo-4-phenylsulfanylspiro[bicyclo[3.1.0]hexane-2,4'-imidazolidine]-6-carboxylate (PubChem CID 11046233) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is ethyl (1R,4R,5R,6R)-2',5'-dioxo-4-phenylsulfanylspiro[bicyclo[3.1.0]hexane-2,4'-imidazolidine]-6-carboxylate.
| Compound Name | ethyl (1R,4R,5R,6R)-2',5'-dioxo-4-phenylsulfanylspiro[bicyclo[3.1.0]hexane-2,4'-imidazolidine]-6-carboxylate |
|---|---|
| PubChem CID | 11046233 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | ethyl (1R,4R,5R,6R)-2',5'-dioxo-4-phenylsulfanylspiro[bicyclo[3.1.0]hexane-2,4'-imidazolidine]-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1C1(C[C@H]2Sc2ccccc2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H18N2O4S/c1-2-23-14(20)12-11-10(24-9-6-4-3-5-7-9)8-17(13(11)12)15(21)18-16(22)19-17/h3-7,10-13H,2,8H2,1H3,(H2,18,19,21,22)/t10-,11+,12+,13+,17?/m1/s1 |
| InChIKey | DJKWSAHQXULSIR-IQDIHOQSSA-N |
| XLogP | 1.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|