C30H52O6SSi2 — CID 11284827
ethyl (1S,2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-ethoxy-2-oxoethyl)-5-phenylsulfanylcyclopentane-1-carboxylate (PubChem CID 11284827) has the molecular formula C30H52O6SSi2 and a molecular weight of 596.98 g/mol. Its IUPAC name is ethyl (1S,2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-ethoxy-2-oxoethyl)-5-phenylsulfanylcyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-ethoxy-2-oxoethyl)-5-phenylsulfanylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11284827 |
| Molecular Formula | C30H52O6SSi2 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | ethyl (1S,2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-ethoxy-2-oxoethyl)-5-phenylsulfanylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](Sc2ccccc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C30H52O6SSi2/c1-13-33-23(31)20-22-24(28(32)34-14-2)27(37-21-18-16-15-17-19-21)26(36-39(11,12)30(6,7)8)25(22)35-38(9,10)29(3,4)5/h15-19,22,24-27H,13-14,20H2,1-12H3/t22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | ZZSJXXOHJIHXLL-SQMKXBQTSA-N |
| XLogP | 7.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|