C20H33NO4Si — CID 15839780
ethyl 2-[(3S,4S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-1,2-oxazolidin-3-yl]acetate (PubChem CID 15839780) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is ethyl 2-[(3S,4S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-1,2-oxazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-1,2-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 15839780 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | ethyl 2-[(3S,4S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-1,2-oxazolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CON1Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO4Si/c1-7-23-19(22)13-17-18(25-26(5,6)20(2,3)4)15-24-21(17)14-16-11-9-8-10-12-16/h8-12,17-18H,7,13-15H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | VJIVFLQAOXNBAK-ZWKOTPCHSA-N |
| XLogP | 4.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|