C22H44O4Si2 — CID 24764392
ethyl 2-[(1R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]acetate (PubChem CID 24764392) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is ethyl 2-[(1R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 24764392 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | ethyl 2-[(1R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C=C(O[Si](C)(C)C(C)(C)C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-12-24-20(23)16-17-15-18(25-27(8,9)21(2,3)4)13-14-19(17)26-28(10,11)22(5,6)7/h15,17,19H,12-14,16H2,1-11H3/t17-,19-/m0/s1 |
| InChIKey | DGKSVGRZPSADPV-HKUYNNGSSA-N |
| XLogP | 6.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|