C16H31NO2Si — CID 134979554
1-[(1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)cyclohex-3-en-1-yl]ethanone (PubChem CID 134979554) has the molecular formula C16H31NO2Si and a molecular weight of 297.52 g/mol. Its IUPAC name is 1-[(1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)cyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)cyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 134979554 |
| Molecular Formula | C16H31NO2Si |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-[(1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)cyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCC(O[Si](C)(C)C(C)(C)C)=C[C@H]1N(C)C |
| InChI | InChI=1S/C16H31NO2Si/c1-12(18)14-10-9-13(11-15(14)17(5)6)19-20(7,8)16(2,3)4/h11,14-15H,9-10H2,1-8H3/t14-,15+/m0/s1 |
| InChIKey | RFPQLXCVOCIEGV-LSDHHAIUSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|