C22H33NO3Si — CID 100972470
methyl (1R,2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3-dihydroindol-1-yl)cyclohex-3-ene-1-carboxylate (PubChem CID 100972470) has the molecular formula C22H33NO3Si and a molecular weight of 387.60 g/mol. Its IUPAC name is methyl (1R,2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3-dihydroindol-1-yl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3-dihydroindol-1-yl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 100972470 |
| Molecular Formula | C22H33NO3Si |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | methyl (1R,2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3-dihydroindol-1-yl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(O[Si](C)(C)C(C)(C)C)=C[C@@H]1N1CCc2ccccc21 |
| InChI | InChI=1S/C22H33NO3Si/c1-22(2,3)27(5,6)26-17-11-12-18(21(24)25-4)20(15-17)23-14-13-16-9-7-8-10-19(16)23/h7-10,15,18,20H,11-14H2,1-6H3/t18-,20+/m1/s1 |
| InChIKey | GTIMNPRPDZZSIN-QUCCMNQESA-N |
| XLogP | 4.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|