C19H28O5Si — CID 162415230
methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate (PubChem CID 162415230) has the molecular formula C19H28O5Si and a molecular weight of 364.51 g/mol. Its IUPAC name is methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate.
| Compound Name | methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
|---|---|
| PubChem CID | 162415230 |
| Molecular Formula | C19H28O5Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
| SMILES | COC(=O)C12C=CC(OC1=O)[C@H]1CCC(O[Si](C)(C)C(C)(C)C)=C[C@H]12 |
| InChI | InChI=1S/C19H28O5Si/c1-18(2,3)25(5,6)24-12-7-8-13-14(11-12)19(16(20)22-4)10-9-15(13)23-17(19)21/h9-11,13-15H,7-8H2,1-6H3/t13-,14+,15?,19?/m0/s1 |
| InChIKey | CWZRWAJONVMOFQ-ICBLQISZSA-N |
| XLogP | 3.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|