C21H36O6Si — CID 134889283
ethyl (4aR,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 134889283) has the molecular formula C21H36O6Si and a molecular weight of 412.60 g/mol. Its IUPAC name is ethyl (4aR,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4aR,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 134889283 |
| Molecular Formula | C21H36O6Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | ethyl (4aR,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)CC(C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)=CC2OC |
| InChI | InChI=1S/C21H36O6Si/c1-10-25-18(23)21-15(22)13-20(5,6)26-17(21)12-14(11-16(21)24-7)27-28(8,9)19(2,3)4/h11,16-17H,10,12-13H2,1-9H3/t16?,17-,21-/m0/s1 |
| InChIKey | CGVZJTAGTHGKPC-WURXZWLQSA-N |
| XLogP | 4.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|