C23H38O5Si — CID 134946622
methyl (1S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-1-[(E)-hex-4-enoyl]-2-methoxycyclohex-3-ene-1-carboxylate (PubChem CID 134946622) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is methyl (1S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-1-[(E)-hex-4-enoyl]-2-methoxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-1-[(E)-hex-4-enoyl]-2-methoxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134946622 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl (1S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-1-[(E)-hex-4-enoyl]-2-methoxycyclohex-3-ene-1-carboxylate |
| SMILES | C=CC1=C(O[Si](C)(C)C(C)(C)C)CC[C@](C(=O)CC/C=C/C)(C(=O)OC)C1OC |
| InChI | InChI=1S/C23H38O5Si/c1-10-12-13-14-19(24)23(21(25)27-7)16-15-18(17(11-2)20(23)26-6)28-29(8,9)22(3,4)5/h10-12,20H,2,13-16H2,1,3-9H3/b12-10+/t20?,23-/m1/s1 |
| InChIKey | KLXGJYPDNBSIKE-HIXMKFKKSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|