C28H51FO6Si2 — CID 10257196
1-O-methyl 1-O'-prop-2-enyl (1S,4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohex-2-ene-1,1-dicarboxylate (PubChem CID 10257196) has the molecular formula C28H51FO6Si2 and a molecular weight of 558.88 g/mol. Its IUPAC name is 1-O-methyl 1-O'-prop-2-enyl (1S,4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohex-2-ene-1,1-dicarboxylate.
| Compound Name | 1-O-methyl 1-O'-prop-2-enyl (1S,4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohex-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10257196 |
| Molecular Formula | C28H51FO6Si2 |
| Molecular Weight | 558.88 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-O-methyl 1-O'-prop-2-enyl (1S,4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohex-2-ene-1,1-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@]1(C(=O)OC)C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCF)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H51FO6Si2/c1-13-20-33-25(31)28(24(30)32-8)18-17-22(34-36(9,10)26(2,3)4)21(16-14-15-19-29)23(28)35-37(11,12)27(5,6)7/h13,17-18,21-23H,1,14-16,19-20H2,2-12H3/t21-,22+,23-,28-/m0/s1 |
| InChIKey | SLGRHQNVXFIUCK-KYALDGGBSA-N |
| XLogP | 6.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.88 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|