C31H58O6Si2 — CID 11490144
(6S,7R,8S,9R,10R,11E,14R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethenyl-10-methoxy-7,9,12-trimethyl-1-oxacyclotetradec-11-ene-2,4-dione (PubChem CID 11490144) has the molecular formula C31H58O6Si2 and a molecular weight of 582.97 g/mol. Its IUPAC name is (6S,7R,8S,9R,10R,11E,14R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethenyl-10-methoxy-7,9,12-trimethyl-1-oxacyclotetradec-11-ene-2,4-dione.
| Compound Name | (6S,7R,8S,9R,10R,11E,14R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethenyl-10-methoxy-7,9,12-trimethyl-1-oxacyclotetradec-11-ene-2,4-dione |
|---|---|
| PubChem CID | 11490144 |
| Molecular Formula | C31H58O6Si2 |
| Molecular Weight | 582.97 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | (6S,7R,8S,9R,10R,11E,14R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethenyl-10-methoxy-7,9,12-trimethyl-1-oxacyclotetradec-11-ene-2,4-dione |
| SMILES | C=C[C@H]1C/C(C)=C/[C@@H](OC)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C31H58O6Si2/c1-16-25-17-21(2)18-26(34-11)22(3)29(37-39(14,15)31(8,9)10)23(4)27(19-24(32)20-28(33)35-25)36-38(12,13)30(5,6)7/h16,18,22-23,25-27,29H,1,17,19-20H2,2-15H3/b21-18+/t22-,23-,25+,26-,27+,29+/m1/s1 |
| InChIKey | HDSUZZNFXQIXRN-NWFOMWDHSA-N |
| XLogP | 7.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.97 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|