C36H74O7Si3 — CID 102399782
methyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate (PubChem CID 102399782) has the molecular formula C36H74O7Si3 and a molecular weight of 703.24 g/mol. Its IUPAC name is methyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate.
| Compound Name | methyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
|---|---|
| PubChem CID | 102399782 |
| Molecular Formula | C36H74O7Si3 |
| Molecular Weight | 703.24 g/mol |
| Exact Mass | 702.47 |
| IUPAC Name | methyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)=O |
| InChI | InChI=1S/C36H74O7Si3/c1-21-46(22-2,23-3)43-31(28(7)32(39-15)33(34(38)40-16)42-45(19,20)36(12,13)14)27(6)30(26(5)24-25(4)29(8)37)41-44(17,18)35(9,10)11/h24-25,27-28,30-33H,21-23H2,1-20H3/b26-24+/t25-,27+,28+,30-,31-,32-,33+/m0/s1 |
| InChIKey | BMGWNIZZZUKRMU-UYZXVMJBSA-N |
| XLogP | 9.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.24 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|