C39H80O6Si3 — CID 57342229
tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxydodec-8-enoate (PubChem CID 57342229) has the molecular formula C39H80O6Si3 and a molecular weight of 729.32 g/mol. Its IUPAC name is tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxydodec-8-enoate.
| Compound Name | tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
|---|---|
| PubChem CID | 57342229 |
| Molecular Formula | C39H80O6Si3 |
| Molecular Weight | 729.32 g/mol |
| Exact Mass | 728.53 |
| IUPAC Name | tert-butyl (E,3R,5S,6R,7R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,10-pentamethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)C(C)=O)C(C)(C)[C@@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H80O6Si3/c1-23-48(24-2,25-3)45-35(30(6)34(29(5)26-28(4)31(7)40)44-47(21,22)38(14,15)16)39(17,18)32(27-33(41)42-36(8,9)10)43-46(19,20)37(11,12)13/h26,28,30,32,34-35H,23-25,27H2,1-22H3/b29-26+/t28-,30-,32-,34+,35+/m1/s1 |
| InChIKey | HKSWGAMIZHQXCD-SXMXUDGNSA-N |
| XLogP | 11.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.32 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|