C24H44O4Si — CID 12000578
(6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(2S)-4-oxopentan-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 12000578) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(2S)-4-oxopentan-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(2S)-4-oxopentan-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 12000578 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(2S)-4-oxopentan-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | CC(=O)C[C@H](C)[C@H]1C/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CCCC(=O)O1 |
| InChI | InChI=1S/C24H44O4Si/c1-17-13-14-21(19(3)16-20(4)25)27-23(26)12-10-11-22(18(2)15-17)28-29(8,9)24(5,6)7/h13,18-19,21-22H,10-12,14-16H2,1-9H3/b17-13+/t18-,19-,21+,22-/m0/s1 |
| InChIKey | LCCVEANCFURESO-WHUFISOASA-N |
| XLogP | 6.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|