C33H60O5Si — CID 56930011
(6S,7S,9E,12R)-12-[(E,2S,6R)-6-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-4-methylhept-4-en-2-yl]-6-hydroxy-7,9-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 56930011) has the molecular formula C33H60O5Si and a molecular weight of 564.92 g/mol. Its IUPAC name is (6S,7S,9E,12R)-12-[(E,2S,6R)-6-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-4-methylhept-4-en-2-yl]-6-hydroxy-7,9-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,9E,12R)-12-[(E,2S,6R)-6-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-4-methylhept-4-en-2-yl]-6-hydroxy-7,9-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 56930011 |
| Molecular Formula | C33H60O5Si |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | (6S,7S,9E,12R)-12-[(E,2S,6R)-6-[(4R,6R)-2,2-ditert-butyl-6-methyl-1,3,2-dioxasilinan-4-yl]-4-methylhept-4-en-2-yl]-6-hydroxy-7,9-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C1=C\C[C@H]([C@@H](C)C/C(C)=C/[C@@H](C)[C@H]2C[C@@H](C)O[Si](C(C)(C)C)(C(C)(C)C)O2)OC(=O)CCC[C@H](O)[C@@H](C)C1 |
| InChI | InChI=1S/C33H60O5Si/c1-22-16-17-29(36-31(35)15-13-14-28(34)24(3)18-22)25(4)19-23(2)20-26(5)30-21-27(6)37-39(38-30,32(7,8)9)33(10,11)12/h16,20,24-30,34H,13-15,17-19,21H2,1-12H3/b22-16+,23-20+/t24-,25-,26+,27+,28-,29+,30+/m0/s1 |
| InChIKey | IHAAJZPLBSTJRB-WRFDLULRSA-N |
| XLogP | 8.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|