C20H40O4Si — CID 102104116
ethyl (E,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4,6-tetramethyloct-6-enoate (PubChem CID 102104116) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is ethyl (E,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4,6-tetramethyloct-6-enoate.
| Compound Name | ethyl (E,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4,6-tetramethyloct-6-enoate |
|---|---|
| PubChem CID | 102104116 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | ethyl (E,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2,4,6-tetramethyloct-6-enoate |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C20H40O4Si/c1-12-14(3)16(24-25(10,11)19(5,6)7)15(4)17(21)20(8,9)18(22)23-13-2/h12,15-17,21H,13H2,1-11H3/b14-12+/t15-,16-,17+/m0/s1 |
| InChIKey | NUGLCFVZNLYFEH-AGPLGXMXSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|