C37H76O5Si3 — CID 57342058
tert-butyl (3R,5S,6R,7R,8E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-triethylsilyloxyundeca-8,10-dienoate (PubChem CID 57342058) has the molecular formula C37H76O5Si3 and a molecular weight of 685.27 g/mol. Its IUPAC name is tert-butyl (3R,5S,6R,7R,8E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-triethylsilyloxyundeca-8,10-dienoate.
| Compound Name | tert-butyl (3R,5S,6R,7R,8E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-triethylsilyloxyundeca-8,10-dienoate |
|---|---|
| PubChem CID | 57342058 |
| Molecular Formula | C37H76O5Si3 |
| Molecular Weight | 685.27 g/mol |
| Exact Mass | 684.50 |
| IUPAC Name | tert-butyl (3R,5S,6R,7R,8E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-triethylsilyloxyundeca-8,10-dienoate |
| SMILES | C=C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](O[Si](CC)(CC)CC)C(C)(C)[C@@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H76O5Si3/c1-22-26-28(5)32(41-44(20,21)36(13,14)15)29(6)33(42-45(23-2,24-3)25-4)37(16,17)30(27-31(38)39-34(7,8)9)40-43(18,19)35(10,11)12/h22,26,29-30,32-33H,1,23-25,27H2,2-21H3/b28-26+/t29-,30-,32+,33+/m1/s1 |
| InChIKey | ZLMOVCJPGVYQMT-FNCARDSYSA-N |
| XLogP | 11.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.27 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|