C30H56O5Si — CID 134937172
(6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(E,2S,7S,9R)-7,9-dihydroxy-4-methyldec-4-en-2-yl]-7,9-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 134937172) has the molecular formula C30H56O5Si and a molecular weight of 524.86 g/mol. Its IUPAC name is (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(E,2S,7S,9R)-7,9-dihydroxy-4-methyldec-4-en-2-yl]-7,9-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(E,2S,7S,9R)-7,9-dihydroxy-4-methyldec-4-en-2-yl]-7,9-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 134937172 |
| Molecular Formula | C30H56O5Si |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-[(E,2S,7S,9R)-7,9-dihydroxy-4-methyldec-4-en-2-yl]-7,9-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C1=C\C[C@H]([C@@H](C)C/C(C)=C/C[C@H](O)C[C@@H](C)O)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C30H56O5Si/c1-21(14-16-26(32)20-25(5)31)18-23(3)27-17-15-22(2)19-24(4)28(12-11-13-29(33)34-27)35-36(9,10)30(6,7)8/h14-15,23-28,31-32H,11-13,16-20H2,1-10H3/b21-14+,22-15+/t23-,24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | LGBSZMNZYGHASC-PHNSFORVSA-N |
| XLogP | 7.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|