C18H36O4Si — CID 10991561
(3R,4S,7S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyldec-9-enoic acid (PubChem CID 10991561) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (3R,4S,7S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyldec-9-enoic acid.
| Compound Name | (3R,4S,7S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyldec-9-enoic acid |
|---|---|
| PubChem CID | 10991561 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3R,4S,7S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyldec-9-enoic acid |
| SMILES | C=C[C@@H](C)[C@@H](O)CC[C@H](C)[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-9-13(2)15(19)11-10-14(3)16(12-17(20)21)22-23(7,8)18(4,5)6/h9,13-16,19H,1,10-12H2,2-8H3,(H,20,21)/t13-,14+,15+,16-/m1/s1 |
| InChIKey | QAHBBZSLVZOAMY-FXUDXRNXSA-N |
| XLogP | 4.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|