C28H58O4Si2 — CID 134948846
(2R,5S,6R,9R)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-2,6-dimethyltetradec-13-en-7-one (PubChem CID 134948846) has the molecular formula C28H58O4Si2 and a molecular weight of 514.94 g/mol. Its IUPAC name is (2R,5S,6R,9R)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-2,6-dimethyltetradec-13-en-7-one.
| Compound Name | (2R,5S,6R,9R)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-2,6-dimethyltetradec-13-en-7-one |
|---|---|
| PubChem CID | 134948846 |
| Molecular Formula | C28H58O4Si2 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | (2R,5S,6R,9R)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-2,6-dimethyltetradec-13-en-7-one |
| SMILES | C=CCCC[C@H](CC(=O)[C@H](C)[C@@H](O)CC[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O4Si2/c1-14-15-16-17-24(32-34(12,13)28(7,8)9)20-26(30)23(3)25(29)19-18-22(2)21-31-33(10,11)27(4,5)6/h14,22-25,29H,1,15-21H2,2-13H3/t22-,23-,24-,25+/m1/s1 |
| InChIKey | OVOUAMYCRGFWKY-VPBXCIAMSA-N |
| XLogP | 8.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|