C28H56O4Si2 — CID 134948843
(2R,5S,6R,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethyl-7-oxotetradec-13-enal (PubChem CID 134948843) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is (2R,5S,6R,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethyl-7-oxotetradec-13-enal.
| Compound Name | (2R,5S,6R,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethyl-7-oxotetradec-13-enal |
|---|---|
| PubChem CID | 134948843 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (2R,5S,6R,9R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethyl-7-oxotetradec-13-enal |
| SMILES | C=CCCC[C@H](CC(=O)[C@H](C)[C@H](CC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-14-15-16-17-24(31-33(10,11)27(4,5)6)20-25(30)23(3)26(19-18-22(2)21-29)32-34(12,13)28(7,8)9/h14,21-24,26H,1,15-20H2,2-13H3/t22-,23+,24-,26+/m1/s1 |
| InChIKey | SDTLVZDNGVINNZ-TWZJLLKVSA-N |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|