C18H31BrO3Si — CID 66560282
prop-2-enyl (2S,3R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloct-7-ynoate (PubChem CID 66560282) has the molecular formula C18H31BrO3Si and a molecular weight of 403.43 g/mol. Its IUPAC name is prop-2-enyl (2S,3R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloct-7-ynoate.
| Compound Name | prop-2-enyl (2S,3R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloct-7-ynoate |
|---|---|
| PubChem CID | 66560282 |
| Molecular Formula | C18H31BrO3Si |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | prop-2-enyl (2S,3R)-8-bromo-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloct-7-ynoate |
| SMILES | C=CCOC(=O)[C@@H](C)[C@@H](CCCC#CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31BrO3Si/c1-8-14-21-17(20)15(2)16(12-10-9-11-13-19)22-23(6,7)18(3,4)5/h8,15-16H,1,9-10,12,14H2,2-7H3/t15-,16+/m0/s1 |
| InChIKey | DLSWRMDBXUIWHG-JKSUJKDBSA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|