C23H46O4Si2 — CID 71544922
prop-2-enyl (Z)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-2-enoate (PubChem CID 71544922) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is prop-2-enyl (Z)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-2-enoate.
| Compound Name | prop-2-enyl (Z)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-2-enoate |
|---|---|
| PubChem CID | 71544922 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | prop-2-enyl (Z)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-2-enoate |
| SMILES | C=CCOC(=O)/C=C(/C)C(CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si2/c1-13-16-25-21(24)18-19(2)20(27-29(11,12)23(6,7)8)15-14-17-26-28(9,10)22(3,4)5/h13,18,20H,1,14-17H2,2-12H3/b19-18- |
| InChIKey | GRURHZQIIWZHSE-HNENSFHCSA-N |
| XLogP | 6.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|