C18H34O4Si — CID 100970635
[9-[tert-butyl(dimethyl)silyl]oxy-3-methylidenenon-1-en-4-yl] methyl carbonate (PubChem CID 100970635) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [9-[tert-butyl(dimethyl)silyl]oxy-3-methylidenenon-1-en-4-yl] methyl carbonate.
| Compound Name | [9-[tert-butyl(dimethyl)silyl]oxy-3-methylidenenon-1-en-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 100970635 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [9-[tert-butyl(dimethyl)silyl]oxy-3-methylidenenon-1-en-4-yl] methyl carbonate |
| SMILES | C=CC(=C)C(CCCCCO[Si](C)(C)C(C)(C)C)OC(=O)OC |
| InChI | InChI=1S/C18H34O4Si/c1-9-15(2)16(22-17(19)20-6)13-11-10-12-14-21-23(7,8)18(3,4)5/h9,16H,1-2,10-14H2,3-8H3 |
| InChIKey | ARIBSFKMMUAFCR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|