C16H33O7PSi — CID 101138901
prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-diethoxyphosphoryloxypropanoate (PubChem CID 101138901) has the molecular formula C16H33O7PSi and a molecular weight of 396.49 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-diethoxyphosphoryloxypropanoate.
| Compound Name | prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-diethoxyphosphoryloxypropanoate |
|---|---|
| PubChem CID | 101138901 |
| Molecular Formula | C16H33O7PSi |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-diethoxyphosphoryloxypropanoate |
| SMILES | C=CCOC(=O)[C@H](COP(=O)(OCC)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33O7PSi/c1-9-12-19-15(17)14(23-25(7,8)16(4,5)6)13-22-24(18,20-10-2)21-11-3/h9,14H,1,10-13H2,2-8H3/t14-/m0/s1 |
| InChIKey | MILCUENLMKPDRS-AWEZNQCLSA-N |
| XLogP | 4.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|