C13H29O4PSi — CID 57238883
tert-butyl-[1-[ethoxy(ethyl)phosphoryl]oxyprop-2-enoxy]-dimethylsilane (PubChem CID 57238883) has the molecular formula C13H29O4PSi and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl-[1-[ethoxy(ethyl)phosphoryl]oxyprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[ethoxy(ethyl)phosphoryl]oxyprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 57238883 |
| Molecular Formula | C13H29O4PSi |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | tert-butyl-[1-[ethoxy(ethyl)phosphoryl]oxyprop-2-enoxy]-dimethylsilane |
| SMILES | C=CC(O[Si](C)(C)C(C)(C)C)OP(=O)(CC)OCC |
| InChI | InChI=1S/C13H29O4PSi/c1-9-12(16-18(14,11-3)15-10-2)17-19(7,8)13(4,5)6/h9,12H,1,10-11H2,2-8H3 |
| InChIKey | BMTZWSRHSMWFCK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|