C10H23O3P — CID 170850874
3-[ethoxy(ethyl)phosphoryl]oxy-2,2-dimethylbutane (PubChem CID 170850874) has the molecular formula C10H23O3P and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-[ethoxy(ethyl)phosphoryl]oxy-2,2-dimethylbutane.
| Compound Name | 3-[ethoxy(ethyl)phosphoryl]oxy-2,2-dimethylbutane |
|---|---|
| PubChem CID | 170850874 |
| Molecular Formula | C10H23O3P |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-[ethoxy(ethyl)phosphoryl]oxy-2,2-dimethylbutane |
| SMILES | CCOP(=O)(CC)OC(C)C(C)(C)C |
| InChI | InChI=1S/C10H23O3P/c1-7-12-14(11,8-2)13-9(3)10(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | NRZNOCNQGJCPIZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|