C13H29O3P — CID 170850671
2-[3,3-dimethylbutan-2-yloxy(methyl)phosphoryl]oxy-3-methylpentane (PubChem CID 170850671) has the molecular formula C13H29O3P and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[3,3-dimethylbutan-2-yloxy(methyl)phosphoryl]oxy-3-methylpentane.
| Compound Name | 2-[3,3-dimethylbutan-2-yloxy(methyl)phosphoryl]oxy-3-methylpentane |
|---|---|
| PubChem CID | 170850671 |
| Molecular Formula | C13H29O3P |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 2-[3,3-dimethylbutan-2-yloxy(methyl)phosphoryl]oxy-3-methylpentane |
| SMILES | CCC(C)C(C)OP(C)(=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C13H29O3P/c1-9-10(2)11(3)15-17(8,14)16-12(4)13(5,6)7/h10-12H,9H2,1-8H3 |
| InChIKey | BIIRVVPSWTXQSB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|