C13H32 — CID 178131669
(3R)-2,3-dimethylpentane;ethane;ethene (PubChem CID 178131669) has the molecular formula C13H32 and a molecular weight of 188.40 g/mol. Its IUPAC name is (3R)-2,3-dimethylpentane;ethane;ethene.
| Compound Name | (3R)-2,3-dimethylpentane;ethane;ethene |
|---|---|
| PubChem CID | 178131669 |
| Molecular Formula | C13H32 |
| Molecular Weight | 188.40 g/mol |
| Exact Mass | 188.25 |
| IUPAC Name | (3R)-2,3-dimethylpentane;ethane;ethene |
| SMILES | C=C.CC.CC.CC[C@@H](C)C(C)C |
| InChI | InChI=1S/C7H16.2C2H6.C2H4/c1-5-7(4)6(2)3;3*1-2/h6-7H,5H2,1-4H3;2*1-2H3;1-2H2/t7-;;;/m1.../s1 |
| InChIKey | HQRVOPUUHAEWNO-LSBIWMFESA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|