C14H34S — CID 171505915
2,3-dimethylbutane;2,3-dimethylpentane;methanethiol (PubChem CID 171505915) has the molecular formula C14H34S and a molecular weight of 234.49 g/mol. Its IUPAC name is 2,3-dimethylbutane;2,3-dimethylpentane;methanethiol.
| Compound Name | 2,3-dimethylbutane;2,3-dimethylpentane;methanethiol |
|---|---|
| PubChem CID | 171505915 |
| Molecular Formula | C14H34S |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.24 |
| IUPAC Name | 2,3-dimethylbutane;2,3-dimethylpentane;methanethiol |
| SMILES | CC(C)C(C)C.CCC(C)C(C)C.CS |
| InChI | InChI=1S/C7H16.C6H14.CH4S/c1-5-7(4)6(2)3;1-5(2)6(3)4;1-2/h6-7H,5H2,1-4H3;5-6H,1-4H3;2H,1H3 |
| InChIKey | UWQUFLFDXNOKAB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|