C11H27N — CID 162382755
2,3-dimethylpentane;N-methylpropan-1-amine (PubChem CID 162382755) has the molecular formula C11H27N and a molecular weight of 173.34 g/mol. Its IUPAC name is 2,3-dimethylpentane;N-methylpropan-1-amine.
| Compound Name | 2,3-dimethylpentane;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 162382755 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | 2,3-dimethylpentane;N-methylpropan-1-amine |
| SMILES | CCC(C)C(C)C.CCCNC |
| InChI | InChI=1S/C7H16.C4H11N/c1-5-7(4)6(2)3;1-3-4-5-2/h6-7H,5H2,1-4H3;5H,3-4H2,1-2H3 |
| InChIKey | IFGFUAILBPBQIA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |