C13H33N — CID 145138668
ethane;N,3,4-trimethylhexan-1-amine (PubChem CID 145138668) has the molecular formula C13H33N and a molecular weight of 203.41 g/mol. Its IUPAC name is ethane;N,3,4-trimethylhexan-1-amine.
| Compound Name | ethane;N,3,4-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 145138668 |
| Molecular Formula | C13H33N |
| Molecular Weight | 203.41 g/mol |
| Exact Mass | 203.26 |
| IUPAC Name | ethane;N,3,4-trimethylhexan-1-amine |
| SMILES | CC.CC.CCC(C)C(C)CCNC |
| InChI | InChI=1S/C9H21N.2C2H6/c1-5-8(2)9(3)6-7-10-4;2*1-2/h8-10H,5-7H2,1-4H3;2*1-2H3 |
| InChIKey | OSMSESUCPXPJGR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |