C10H24N2 — CID 118478770
3-N-butan-2-yl-1-N-methylpentane-1,3-diamine (PubChem CID 118478770) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 3-N-butan-2-yl-1-N-methylpentane-1,3-diamine.
| Compound Name | 3-N-butan-2-yl-1-N-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 118478770 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 3-N-butan-2-yl-1-N-methylpentane-1,3-diamine |
| SMILES | CCC(C)NC(CC)CCNC |
| InChI | InChI=1S/C10H24N2/c1-5-9(3)12-10(6-2)7-8-11-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | ZUVGLTZORVADSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |