C10H23N — CID 171815498
N,3-dimethylpentan-1-amine;prop-1-ene (PubChem CID 171815498) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is N,3-dimethylpentan-1-amine;prop-1-ene.
| Compound Name | N,3-dimethylpentan-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 171815498 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N,3-dimethylpentan-1-amine;prop-1-ene |
| SMILES | C=CC.CCC(C)CCNC |
| InChI | InChI=1S/C7H17N.C3H6/c1-4-7(2)5-6-8-3;1-3-2/h7-8H,4-6H2,1-3H3;3H,1H2,2H3 |
| InChIKey | JOOOIGMFWXRBMZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|