C10H26 — CID 143379754
2,3-dimethylpentane;ethane;methane (PubChem CID 143379754) has the molecular formula C10H26 and a molecular weight of 146.32 g/mol. Its IUPAC name is 2,3-dimethylpentane;ethane;methane.
| Compound Name | 2,3-dimethylpentane;ethane;methane |
|---|---|
| PubChem CID | 143379754 |
| Molecular Formula | C10H26 |
| Molecular Weight | 146.32 g/mol |
| Exact Mass | 146.20 |
| IUPAC Name | 2,3-dimethylpentane;ethane;methane |
| SMILES | C.CC.CCC(C)C(C)C |
| InChI | InChI=1S/C7H16.C2H6.CH4/c1-5-7(4)6(2)3;1-2;/h6-7H,5H2,1-4H3;1-2H3;1H4 |
| InChIKey | MIMZBIPLIGIPDU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |