C11H24 — CID 145154125
cyclobutane;2,3-dimethylpentane (PubChem CID 145154125) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is cyclobutane;2,3-dimethylpentane.
| Compound Name | cyclobutane;2,3-dimethylpentane |
|---|---|
| PubChem CID | 145154125 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | cyclobutane;2,3-dimethylpentane |
| SMILES | C1CCC1.CCC(C)C(C)C |
| InChI | InChI=1S/C7H16.C4H8/c1-5-7(4)6(2)3;1-2-4-3-1/h6-7H,5H2,1-4H3;1-4H2 |
| InChIKey | FCLMMWFHWSOVES-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |