C18H23O2P — CID 12869475
[3,3-dimethylbutan-2-yloxy(phenyl)phosphoryl]benzene (PubChem CID 12869475) has the molecular formula C18H23O2P and a molecular weight of 302.35 g/mol. Its IUPAC name is [3,3-dimethylbutan-2-yloxy(phenyl)phosphoryl]benzene.
| Compound Name | [3,3-dimethylbutan-2-yloxy(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 12869475 |
| Molecular Formula | C18H23O2P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [3,3-dimethylbutan-2-yloxy(phenyl)phosphoryl]benzene |
| SMILES | CC(OP(=O)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H23O2P/c1-15(18(2,3)4)20-21(19,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15H,1-4H3 |
| InChIKey | XOHVCXLFLGWKBE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|