C31H34O4P2 — CID 90416172
[(4-diphenylphosphoryloxy-3,3-dimethylpentan-2-yl)oxy-phenylphosphoryl]benzene (PubChem CID 90416172) has the molecular formula C31H34O4P2 and a molecular weight of 532.56 g/mol. Its IUPAC name is [(4-diphenylphosphoryloxy-3,3-dimethylpentan-2-yl)oxy-phenylphosphoryl]benzene.
| Compound Name | [(4-diphenylphosphoryloxy-3,3-dimethylpentan-2-yl)oxy-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 90416172 |
| Molecular Formula | C31H34O4P2 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | [(4-diphenylphosphoryloxy-3,3-dimethylpentan-2-yl)oxy-phenylphosphoryl]benzene |
| SMILES | CC(OP(=O)(c1ccccc1)c1ccccc1)C(C)(C)C(C)OP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34O4P2/c1-25(34-36(32,27-17-9-5-10-18-27)28-19-11-6-12-20-28)31(3,4)26(2)35-37(33,29-21-13-7-14-22-29)30-23-15-8-16-24-30/h5-26H,1-4H3 |
| InChIKey | PCTUROFRZIFZFI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|