C20H15F4O2P — CID 2054839
1-[(1S)-1-diphenylphosphoryloxy-2,2,2-trifluoroethyl]-4-fluorobenzene (PubChem CID 2054839) has the molecular formula C20H15F4O2P and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[(1S)-1-diphenylphosphoryloxy-2,2,2-trifluoroethyl]-4-fluorobenzene.
| Compound Name | 1-[(1S)-1-diphenylphosphoryloxy-2,2,2-trifluoroethyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 2054839 |
| Molecular Formula | C20H15F4O2P |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[(1S)-1-diphenylphosphoryloxy-2,2,2-trifluoroethyl]-4-fluorobenzene |
| SMILES | O=P(O[C@@H](c1ccc(F)cc1)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15F4O2P/c21-16-13-11-15(12-14-16)19(20(22,23)24)26-27(25,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,19H/t19-/m0/s1 |
| InChIKey | CROLSFSRTGJEEP-IBGZPJMESA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|