C18H14F9O3P — CID 91500438
[2,2,2-trifluoro-1-[2,2,2-trifluoroethyl-(2,2,2-trifluoro-1-phenylethoxy)phosphoryl]oxyethyl]benzene (PubChem CID 91500438) has the molecular formula C18H14F9O3P and a molecular weight of 480.26 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-[2,2,2-trifluoroethyl-(2,2,2-trifluoro-1-phenylethoxy)phosphoryl]oxyethyl]benzene.
| Compound Name | [2,2,2-trifluoro-1-[2,2,2-trifluoroethyl-(2,2,2-trifluoro-1-phenylethoxy)phosphoryl]oxyethyl]benzene |
|---|---|
| PubChem CID | 91500438 |
| Molecular Formula | C18H14F9O3P |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | [2,2,2-trifluoro-1-[2,2,2-trifluoroethyl-(2,2,2-trifluoro-1-phenylethoxy)phosphoryl]oxyethyl]benzene |
| SMILES | O=P(CC(F)(F)F)(OC(c1ccccc1)C(F)(F)F)OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H14F9O3P/c19-16(20,21)11-31(28,29-14(17(22,23)24)12-7-3-1-4-8-12)30-15(18(25,26)27)13-9-5-2-6-10-13/h1-10,14-15H,11H2 |
| InChIKey | DSNTVAHHSFTXGH-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|