C12H15F3O3P- — CID 154047216
butyl-(2,2,2-trifluoro-1-phenylethoxy)phosphinate (PubChem CID 154047216) has the molecular formula C12H15F3O3P- and a molecular weight of 295.22 g/mol. Its IUPAC name is butyl-(2,2,2-trifluoro-1-phenylethoxy)phosphinate.
| Compound Name | butyl-(2,2,2-trifluoro-1-phenylethoxy)phosphinate |
|---|---|
| PubChem CID | 154047216 |
| Molecular Formula | C12H15F3O3P- |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | butyl-(2,2,2-trifluoro-1-phenylethoxy)phosphinate |
| SMILES | CCCCP(=O)([O-])OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3O3P/c1-2-3-9-19(16,17)18-11(12(13,14)15)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,16,17)/p-1 |
| InChIKey | RSJKBXIQQRCEHX-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|