About butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate
butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate (PubChem CID 154047221) has the molecular formula C12H21F3O3P-
and a molecular weight of 301.27 g/mol. Its IUPAC name is butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate.
Molecular Properties
| Compound Name | butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate |
| PubChem CID | 154047221 |
| Molecular Formula | C12H21F3O3P- |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate |
| SMILES | CCCCP(=O)([O-])OC(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H22F3O3P/c1-2-3-9-19(16,17)18-11(12(13,14)15)10-7-5-4-6-8-10/h10-11H,2-9H2,1H3,(H,16,17)/p-1 |
| InChIKey | TYEPDMKCWVZROT-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate?
The IUPAC name of butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate (CID 154047221) is butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate.
What is the SMILES notation for butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate?
The canonical SMILES for butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate is CCCCP(=O)([O-])OC(C1CCCCC1)C(F)(F)F.
What is the InChIKey of butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate?
The InChIKey is TYEPDMKCWVZROT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H22F3O3P/c1-2-3-9-19(16,17)18-11(12(13,14)15)10-7-5-4-6-8-10/h10-11H,2-9H2,1H3,(H,16,17)/p-1.
What are the key properties of butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate?
butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate has a molecular weight of 301.27 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(1-cyclohexyl-2,2,2-trifluoroethoxy)phosphinate is sourced from PubChem (CID 154047221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).