C11H19F3 — CID 95170510
[(2S)-1,1,1-trifluorohexan-2-yl]cyclopentane (PubChem CID 95170510) has the molecular formula C11H19F3 and a molecular weight of 208.27 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorohexan-2-yl]cyclopentane.
| Compound Name | [(2S)-1,1,1-trifluorohexan-2-yl]cyclopentane |
|---|---|
| PubChem CID | 95170510 |
| Molecular Formula | C11H19F3 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | [(2S)-1,1,1-trifluorohexan-2-yl]cyclopentane |
| SMILES | CCCC[C@@H](C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H19F3/c1-2-3-8-10(11(12,13)14)9-6-4-5-7-9/h9-10H,2-8H2,1H3/t10-/m0/s1 |
| InChIKey | ZUICBPKRTOLBQX-JTQLQIEISA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |