C15H30O — CID 149361813
4-(2,2-dimethylheptan-3-yl)cyclohexan-1-ol (PubChem CID 149361813) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 4-(2,2-dimethylheptan-3-yl)cyclohexan-1-ol.
| Compound Name | 4-(2,2-dimethylheptan-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 149361813 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 4-(2,2-dimethylheptan-3-yl)cyclohexan-1-ol |
| SMILES | CCCCC(C1CCC(O)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H30O/c1-5-6-7-14(15(2,3)4)12-8-10-13(16)11-9-12/h12-14,16H,5-11H2,1-4H3 |
| InChIKey | YIBBAOFINCXINM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |